Smiles Code
[2H]C([2H])([2H])C(N)(C([2H])([2H])[2H])C([2H])([2H])[2H]
Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly)
Building Blocks; Isotopic Labeled Analogues; Miscellaneous;
tert-Butylamine is common reagent in pharmaceuticals syntheses. Used in the preparation of aminoBODIPY compounds for chemical analyses. Also it aids in the synthesis of benzylurea-based insecticides containing amide and sulfonate groups. It has also been used in the synthesis of BPTES analogs, that act as glutaminase inhibitors, which can attenuate the growth of human lymphoma B cells. This is the labeled analog.